ChemNet > CAS > 465514-67-4 4-[2-(3-methoxyphenyl)acetyl]benzonitrile
465514-67-4 4-[2-(3-methoxyphenyl)acetyl]benzonitrile
اسم المنتج |
4-[2-(3-methoxyphenyl)acetyl]benzonitrile |
الاسم المستعار |
4-[(3-methoxyphenyl)acetyl]benzonitrile |
الصيغة الجزيئية |
C16H13NO2 |
الوزن الجزيئي الغرامي |
251.2799 |
InChI |
InChI=1/C16H13NO2/c1-19-15-4-2-3-13(9-15)10-16(18)14-7-5-12(11-17)6-8-14/h2-9H,10H2,1H3 |
إستراتيجية المساعدة القطرية |
465514-67-4 |
بنية جزيئية |
|
كثافة |
1.18g/cm3 |
درجة الإنصهار |
113.9℃ |
نقطة الغليان |
445.6°C at 760 mmHg |
معامل الإنكسار |
1.592 |
نقطة الوميض |
194.4°C |
علامات على البضائع الخطرة |
Xn:Harmful;
|
خطر المصطلحات |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
شروط الأمن |
S36/37:Wear suitable protective clothing and gloves.;
|
|